C26H20FNO3S — CID 4244195
methyl 2-[(2,2-diphenylacetyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 4244195) has the molecular formula C26H20FNO3S and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl 2-[(2,2-diphenylacetyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2,2-diphenylacetyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4244195 |
| Molecular Formula | C26H20FNO3S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | methyl 2-[(2,2-diphenylacetyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20FNO3S/c1-31-26(30)23-21(17-12-14-20(27)15-13-17)16-32-25(23)28-24(29)22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-16,22H,1H3,(H,28,29) |
| InChIKey | QLMRGTSKGORPTN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|