C21H19NO5S — CID 3554816
methyl 2-[(2,6-dimethoxybenzoyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3554816) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 2-[(2,6-dimethoxybenzoyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2,6-dimethoxybenzoyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3554816 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | methyl 2-[(2,6-dimethoxybenzoyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)csc1NC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C21H19NO5S/c1-25-15-10-7-11-16(26-2)18(15)19(23)22-20-17(21(24)27-3)14(12-28-20)13-8-5-4-6-9-13/h4-12H,1-3H3,(H,22,23) |
| InChIKey | DJSICVNPYHTGSI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|