C20H16ClNO4S — CID 2241799
methyl 2-[(2-chlorobenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 2241799) has the molecular formula C20H16ClNO4S and a molecular weight of 401.87 g/mol. Its IUPAC name is methyl 2-[(2-chlorobenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-chlorobenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241799 |
| Molecular Formula | C20H16ClNO4S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | methyl 2-[(2-chlorobenzoyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H16ClNO4S/c1-25-13-9-7-12(8-10-13)15-11-27-19(17(15)20(24)26-2)22-18(23)14-5-3-4-6-16(14)21/h3-11H,1-2H3,(H,22,23) |
| InChIKey | VGOGHHQSGSAKDN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|