C26H18FNO4S — CID 4173417
methyl 4-(4-fluorophenyl)-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate (PubChem CID 4173417) has the molecular formula C26H18FNO4S and a molecular weight of 459.50 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4173417 |
| Molecular Formula | C26H18FNO4S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C26H18FNO4S/c1-31-26(30)23-19(15-10-12-16(27)13-11-15)14-33-25(23)28-24(29)22-17-6-2-4-8-20(17)32-21-9-5-3-7-18(21)22/h2-14,22H,1H3,(H,28,29) |
| InChIKey | DMGWPYNYHVMAJF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|