C22H18N2O5S — CID 2971056
methyl 5-carbamoyl-4-methyl-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate (PubChem CID 2971056) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is methyl 5-carbamoyl-4-methyl-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-carbamoyl-4-methyl-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2971056 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | methyl 5-carbamoyl-4-methyl-2-(9H-xanthene-9-carbonylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2c3ccccc3Oc3ccccc32)sc(C(N)=O)c1C |
| InChI | InChI=1S/C22H18N2O5S/c1-11-16(22(27)28-2)21(30-18(11)19(23)25)24-20(26)17-12-7-3-5-9-14(12)29-15-10-6-4-8-13(15)17/h3-10,17H,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | FMPHVGPORFHUAW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |