C18H17NO6S — CID 51424336
2-O-ethyl 4-O-methyl 3-methyl-5-[[(1R)-3-oxo-1H-2-benzofuran-1-yl]amino]thiophene-2,4-dicarboxylate (PubChem CID 51424336) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl 3-methyl-5-[[(1R)-3-oxo-1H-2-benzofuran-1-yl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl 3-methyl-5-[[(1R)-3-oxo-1H-2-benzofuran-1-yl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 51424336 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-O-ethyl 4-O-methyl 3-methyl-5-[[(1R)-3-oxo-1H-2-benzofuran-1-yl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N[C@@H]2OC(=O)c3ccccc32)c(C(=O)OC)c1C |
| InChI | InChI=1S/C18H17NO6S/c1-4-24-18(22)13-9(2)12(17(21)23-3)15(26-13)19-14-10-7-5-6-8-11(10)16(20)25-14/h5-8,14,19H,4H2,1-3H3/t14-/m1/s1 |
| InChIKey | ASSXUEDCXPUONO-CQSZACIVSA-N |
| XLogP | 3.30 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|