C21H23NO8S — CID 4298814
diethyl 5-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4298814) has the molecular formula C21H23NO8S and a molecular weight of 449.48 g/mol. Its IUPAC name is diethyl 5-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4298814 |
| Molecular Formula | C21H23NO8S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | diethyl 5-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC2OC(=O)c3c2ccc(OC)c3OC)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C21H23NO8S/c1-6-28-19(23)13-10(3)16(21(25)29-7-2)31-18(13)22-17-11-8-9-12(26-4)15(27-5)14(11)20(24)30-17/h8-9,17,22H,6-7H2,1-5H3 |
| InChIKey | WOKSPCINWPSKBH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|