C18H19NO5 — CID 2863991
3-(4-ethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 2863991) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-(4-ethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(4-ethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 2863991 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-(4-ethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | CCOc1ccc(NC2OC(=O)c3c2ccc(OC)c3OC)cc1 |
| InChI | InChI=1S/C18H19NO5/c1-4-23-12-7-5-11(6-8-12)19-17-13-9-10-14(21-2)16(22-3)15(13)18(20)24-17/h5-10,17,19H,4H2,1-3H3 |
| InChIKey | JGAQJJXVBFNXOG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|