C18H19NO6 — CID 3771406
3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 3771406) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 3771406 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc(NC2OC(=O)c3c2ccc(OC)c3OC)cc1OC |
| InChI | InChI=1S/C18H19NO6/c1-21-12-7-5-10(9-14(12)23-3)19-17-11-6-8-13(22-2)16(24-4)15(11)18(20)25-17/h5-9,17,19H,1-4H3 |
| InChIKey | FKVOYQWSIPQIAK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|