About 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one
3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 3771406) has the molecular formula C18H19NO6
and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| PubChem CID | 3771406 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc(NC2OC(=O)c3c2ccc(OC)c3OC)cc1OC |
| InChI | InChI=1S/C18H19NO6/c1-21-12-7-5-10(9-14(12)23-3)19-17-11-6-8-13(22-2)16(24-4)15(11)18(20)25-17/h5-9,17,19H,1-4H3 |
| InChIKey | FKVOYQWSIPQIAK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The IUPAC name of 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (CID 3771406) is 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
What is the SMILES notation for 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The canonical SMILES for 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one is COc1ccc(NC2OC(=O)c3c2ccc(OC)c3OC)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
The InChIKey is FKVOYQWSIPQIAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO6/c1-21-12-7-5-10(9-14(12)23-3)19-17-11-6-8-13(22-2)16(24-4)15(11)18(20)25-17/h5-9,17,19H,1-4H3.
What are the key properties of 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one?
3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one has a molecular weight of 345.35 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one is sourced from PubChem (CID 3771406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).