C20H14F3NO6 — CID 3443986
7-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-4-(trifluoromethyl)chromen-2-one (PubChem CID 3443986) has the molecular formula C20H14F3NO6 and a molecular weight of 421.33 g/mol. Its IUPAC name is 7-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 3443986 |
| Molecular Formula | C20H14F3NO6 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 7-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-4-(trifluoromethyl)chromen-2-one |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H14F3NO6/c1-27-13-6-5-11-16(17(13)28-2)19(26)30-18(11)24-9-3-4-10-12(20(21,22)23)8-15(25)29-14(10)7-9/h3-8,18,24H,1-2H3 |
| InChIKey | NGNWOWJIPFMNPJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|