C17H15NO6 — CID 7657786
3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]amino]benzoic acid (PubChem CID 7657786) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]amino]benzoic acid.
| Compound Name | 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 7657786 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]amino]benzoic acid |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H15NO6/c1-22-12-7-6-11-13(14(12)23-2)17(21)24-15(11)18-10-5-3-4-9(8-10)16(19)20/h3-8,15,18H,1-2H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | IAWPVXRDVVCERK-HNNXBMFYSA-N |
| XLogP | 2.68 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |