C16H15NO4 — CID 2849172
3-anilino-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 2849172) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-anilino-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-anilino-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 2849172 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-anilino-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2Nc1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c1-19-12-9-8-11-13(14(12)20-2)16(18)21-15(11)17-10-6-4-3-5-7-10/h3-9,15,17H,1-2H3 |
| InChIKey | RFVVMJCNEJIRRE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |