C17H16N2O5 — CID 42649057
4-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]benzamide (PubChem CID 42649057) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]benzamide.
| Compound Name | 4-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 42649057 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]benzamide |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H16N2O5/c1-22-12-8-7-11-13(14(12)23-2)17(21)24-16(11)19-10-5-3-9(4-6-10)15(18)20/h3-8,16,19H,1-2H3,(H2,18,20) |
| InChIKey | FAFOMRZWWJXKNA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |