C19H18N2O6 — CID 99987333
4-[[2-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]amino]benzamide (PubChem CID 99987333) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-[[2-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 99987333 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[[2-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]amino]benzamide |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@H]2CC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H18N2O6/c1-25-13-8-7-12-14(27-19(24)16(12)17(13)26-2)9-15(22)21-11-5-3-10(4-6-11)18(20)23/h3-8,14H,9H2,1-2H3,(H2,20,23)(H,21,22)/t14-/m0/s1 |
| InChIKey | APQCPOASMHBEIP-AWEZNQCLSA-N |
| XLogP | 2.04 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |