C13H14O5 — CID 928822
(3R)-6,7-dimethoxy-3-(2-oxopropyl)-3H-2-benzofuran-1-one (PubChem CID 928822) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3R)-6,7-dimethoxy-3-(2-oxopropyl)-3H-2-benzofuran-1-one.
| Compound Name | (3R)-6,7-dimethoxy-3-(2-oxopropyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 928822 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (3R)-6,7-dimethoxy-3-(2-oxopropyl)-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2CC(C)=O |
| InChI | InChI=1S/C13H14O5/c1-7(14)6-10-8-4-5-9(16-2)12(17-3)11(8)13(15)18-10/h4-5,10H,6H2,1-3H3/t10-/m1/s1 |
| InChIKey | JGEKUZOZKUYNLD-SNVBAGLBSA-N |
| XLogP | 1.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |