C18H14NO8- — CID 7391963
2-[2-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]-4-nitrophenolate (PubChem CID 7391963) has the molecular formula C18H14NO8- and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-[2-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]-4-nitrophenolate.
| Compound Name | 2-[2-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7391963 |
| Molecular Formula | C18H14NO8- |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-[2-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]acetyl]-4-nitrophenolate |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2CC(=O)c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C18H15NO8/c1-25-14-6-4-10-15(27-18(22)16(10)17(14)26-2)8-13(21)11-7-9(19(23)24)3-5-12(11)20/h3-7,15,20H,8H2,1-2H3/p-1/t15-/m1/s1 |
| InChIKey | GLIGHEKBKFFXNC-OAHLLOKOSA-M |
| XLogP | 2.17 |
| TPSA | 128.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|