C16H14N4O8 — CID 40851678
(3S)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 40851678) has the molecular formula C16H14N4O8 and a molecular weight of 390.31 g/mol. Its IUPAC name is (3S)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 40851678 |
| Molecular Formula | C16H14N4O8 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3S)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O8/c1-26-12-6-4-9-13(14(12)27-2)16(21)28-15(9)18-17-10-5-3-8(19(22)23)7-11(10)20(24)25/h3-7,15,17-18H,1-2H3/t15-/m0/s1 |
| InChIKey | QJTOZWJPNDHZEC-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|