C17H15BrN2O5 — CID 4763419
4-bromo-N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)benzohydrazide (PubChem CID 4763419) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is 4-bromo-N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)benzohydrazide.
| Compound Name | 4-bromo-N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 4763419 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 4-bromo-N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)benzohydrazide |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN2O5/c1-23-12-8-7-11-13(14(12)24-2)17(22)25-16(11)20-19-15(21)9-3-5-10(18)6-4-9/h3-8,16,20H,1-2H3,(H,19,21) |
| InChIKey | QRRFJPFDGHLWKZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|