C17H22N2O5 — CID 40588533
N'-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]cyclohexanecarbohydrazide (PubChem CID 40588533) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is N'-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]cyclohexanecarbohydrazide.
| Compound Name | N'-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 40588533 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N'-[(1R)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]cyclohexanecarbohydrazide |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@H]2NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O5/c1-22-12-9-8-11-13(14(12)23-2)17(21)24-16(11)19-18-15(20)10-6-4-3-5-7-10/h8-10,16,19H,3-7H2,1-2H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | FQOKFQMVVDEFIC-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|