C17H16N2O6 — CID 7657917
N'-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]-2-hydroxybenzohydrazide (PubChem CID 7657917) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is N'-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 7657917 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N'-[(1S)-4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl]-2-hydroxybenzohydrazide |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H16N2O6/c1-23-12-8-7-10-13(14(12)24-2)17(22)25-16(10)19-18-15(21)9-5-3-4-6-11(9)20/h3-8,16,19-20H,1-2H3,(H,18,21)/t16-/m0/s1 |
| InChIKey | QNJLXSLSIKISDI-INIZCTEOSA-N |
| XLogP | 1.51 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|