C17H18N2O4 — CID 909136
(3R)-6,7-dimethoxy-3-[2-(2-methylphenyl)hydrazinyl]-3H-2-benzofuran-1-one (PubChem CID 909136) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (3R)-6,7-dimethoxy-3-[2-(2-methylphenyl)hydrazinyl]-3H-2-benzofuran-1-one.
| Compound Name | (3R)-6,7-dimethoxy-3-[2-(2-methylphenyl)hydrazinyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 909136 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (3R)-6,7-dimethoxy-3-[2-(2-methylphenyl)hydrazinyl]-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@H]2NNc1ccccc1C |
| InChI | InChI=1S/C17H18N2O4/c1-10-6-4-5-7-12(10)18-19-16-11-8-9-13(21-2)15(22-3)14(11)17(20)23-16/h4-9,16,18-19H,1-3H3/t16-/m1/s1 |
| InChIKey | CVGFIWZMJRLQHL-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|