C18H18N2O6 — CID 4763408
N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-2-methoxybenzohydrazide (PubChem CID 4763408) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-2-methoxybenzohydrazide.
| Compound Name | N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 4763408 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N'-(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNC1OC(=O)c2c1ccc(OC)c2OC |
| InChI | InChI=1S/C18H18N2O6/c1-23-12-7-5-4-6-10(12)16(21)19-20-17-11-8-9-13(24-2)15(25-3)14(11)18(22)26-17/h4-9,17,20H,1-3H3,(H,19,21) |
| InChIKey | JQOXQUUBKOQHCH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|