C16H14N2O7 — CID 7721292
(3S)-3-(2-hydroxy-5-nitroanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 7721292) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 7721292 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (3S)-3-(2-hydroxy-5-nitroanilino)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)O[C@@H]2Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C16H14N2O7/c1-23-12-6-4-9-13(14(12)24-2)16(20)25-15(9)17-10-7-8(18(21)22)3-5-11(10)19/h3-7,15,17,19H,1-2H3/t15-/m0/s1 |
| InChIKey | VODTUICCECVDQV-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|