C26H20N6O10 — CID 5486733
4-[4-(2,4-dinitroanilino)-3-methoxyphenyl]-N-(2,4-dinitrophenyl)-2-methoxyaniline (PubChem CID 5486733) has the molecular formula C26H20N6O10 and a molecular weight of 576.48 g/mol. Its IUPAC name is 4-[4-(2,4-dinitroanilino)-3-methoxyphenyl]-N-(2,4-dinitrophenyl)-2-methoxyaniline.
| Compound Name | 4-[4-(2,4-dinitroanilino)-3-methoxyphenyl]-N-(2,4-dinitrophenyl)-2-methoxyaniline |
|---|---|
| PubChem CID | 5486733 |
| Molecular Formula | C26H20N6O10 |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 4-[4-(2,4-dinitroanilino)-3-methoxyphenyl]-N-(2,4-dinitrophenyl)-2-methoxyaniline |
| SMILES | COc1cc(-c2ccc(Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)ccc1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20N6O10/c1-41-25-11-15(3-7-21(25)27-19-9-5-17(29(33)34)13-23(19)31(37)38)16-4-8-22(26(12-16)42-2)28-20-10-6-18(30(35)36)14-24(20)32(39)40/h3-14,27-28H,1-2H3 |
| InChIKey | JIHCTUPQGPSRBD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 215.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|