C21H20N2O3 — CID 176843400
4-(2,6-dimethylphenyl)-2-methoxy-N-(2-nitrophenyl)aniline (PubChem CID 176843400) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-2-methoxy-N-(2-nitrophenyl)aniline.
| Compound Name | 4-(2,6-dimethylphenyl)-2-methoxy-N-(2-nitrophenyl)aniline |
|---|---|
| PubChem CID | 176843400 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-2-methoxy-N-(2-nitrophenyl)aniline |
| SMILES | COc1cc(-c2c(C)cccc2C)ccc1Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N2O3/c1-14-7-6-8-15(2)21(14)16-11-12-18(20(13-16)26-3)22-17-9-4-5-10-19(17)23(24)25/h4-13,22H,1-3H3 |
| InChIKey | HQMBYMPHWVJPCP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|