C13H9N5O9 — CID 3703226
N-(2-methoxy-5-nitrophenyl)-2,4,6-trinitroaniline (PubChem CID 3703226) has the molecular formula C13H9N5O9 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2,4,6-trinitroaniline.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 3703226 |
| Molecular Formula | C13H9N5O9 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2,4,6-trinitroaniline |
| SMILES | COc1ccc([N+](=O)[O-])cc1Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N5O9/c1-27-12-3-2-7(15(19)20)4-9(12)14-13-10(17(23)24)5-8(16(21)22)6-11(13)18(25)26/h2-6,14H,1H3 |
| InChIKey | YEXXJEFWEIWKOX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 193.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|