C12H6KN7O12 — CID 173446524
potassium;hydride;2,4,6-trinitro-N-(2,4,6-trinitrophenyl)aniline (PubChem CID 173446524) has the molecular formula C12H6KN7O12 and a molecular weight of 479.32 g/mol. Its IUPAC name is potassium;hydride;2,4,6-trinitro-N-(2,4,6-trinitrophenyl)aniline.
| Compound Name | potassium;hydride;2,4,6-trinitro-N-(2,4,6-trinitrophenyl)aniline |
|---|---|
| PubChem CID | 173446524 |
| Molecular Formula | C12H6KN7O12 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | potassium;hydride;2,4,6-trinitro-N-(2,4,6-trinitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1.[H-].[K+] |
| InChI | InChI=1S/C12H5N7O12.K.H/c20-14(21)5-1-7(16(24)25)11(8(2-5)17(26)27)13-12-9(18(28)29)3-6(15(22)23)4-10(12)19(30)31;;/h1-4,13H;;/q;+1;-1 |
| InChIKey | WBKQRFCTLIVECY-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 270.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|