C14H10N6O12 — CID 87172748
2-methyl-1,3,5-trinitrobenzene (PubChem CID 87172748) has the molecular formula C14H10N6O12 and a molecular weight of 454.26 g/mol. Its IUPAC name is 2-methyl-1,3,5-trinitrobenzene.
| Compound Name | 2-methyl-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 87172748 |
| Molecular Formula | C14H10N6O12 |
| Molecular Weight | 454.26 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2-methyl-1,3,5-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-].Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/2C7H5N3O6/c2*1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2*2-3H,1H3 |
| InChIKey | JKQXUHNOKAZKCT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 258.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|