C13H11N3O8 — CID 88762858
benzene-1,4-diol;2-methyl-1,3,5-trinitrobenzene (PubChem CID 88762858) has the molecular formula C13H11N3O8 and a molecular weight of 337.24 g/mol. Its IUPAC name is benzene-1,4-diol;2-methyl-1,3,5-trinitrobenzene.
| Compound Name | benzene-1,4-diol;2-methyl-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 88762858 |
| Molecular Formula | C13H11N3O8 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | benzene-1,4-diol;2-methyl-1,3,5-trinitrobenzene |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-].Oc1ccc(O)cc1 |
| InChI | InChI=1S/C7H5N3O6.C6H6O2/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16;7-5-1-2-6(8)4-3-5/h2-3H,1H3;1-4,7-8H |
| InChIKey | ZBDQBCMEZLHXSU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|