C13H10N2O5 — CID 174957574
4-(2-methyl-4,6-dinitrophenyl)phenol (PubChem CID 174957574) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-(2-methyl-4,6-dinitrophenyl)phenol.
| Compound Name | 4-(2-methyl-4,6-dinitrophenyl)phenol |
|---|---|
| PubChem CID | 174957574 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-(2-methyl-4,6-dinitrophenyl)phenol |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C13H10N2O5/c1-8-6-10(14(17)18)7-12(15(19)20)13(8)9-2-4-11(16)5-3-9/h2-7,16H,1H3 |
| InChIKey | SCSAPLCGCOPRKP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|