About sodium;4-(2,4-dinitrophenyl)phenol;hydride
sodium;4-(2,4-dinitrophenyl)phenol;hydride (PubChem CID 174918783) has the molecular formula C12H9N2NaO5
and a molecular weight of 284.20 g/mol. Its IUPAC name is sodium;4-(2,4-dinitrophenyl)phenol;hydride.
Molecular Properties
| Compound Name | sodium;4-(2,4-dinitrophenyl)phenol;hydride |
| PubChem CID | 174918783 |
| Molecular Formula | C12H9N2NaO5 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | sodium;4-(2,4-dinitrophenyl)phenol;hydride |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(O)cc2)c([N+](=O)[O-])c1.[H-].[Na+] |
| InChI | InChI=1S/C12H8N2O5.Na.H/c15-10-4-1-8(2-5-10)11-6-3-9(13(16)17)7-12(11)14(18)19;;/h1-7,15H;;/q;+1;-1 |
| InChIKey | ANYDQBDJSNAEFA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(2,4-dinitrophenyl)phenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(2,4-dinitrophenyl)phenol;hydride?
The IUPAC name of sodium;4-(2,4-dinitrophenyl)phenol;hydride (CID 174918783) is sodium;4-(2,4-dinitrophenyl)phenol;hydride.
What is the SMILES notation for sodium;4-(2,4-dinitrophenyl)phenol;hydride?
The canonical SMILES for sodium;4-(2,4-dinitrophenyl)phenol;hydride is O=[N+]([O-])c1ccc(-c2ccc(O)cc2)c([N+](=O)[O-])c1.[H-].[Na+].
What is the InChIKey of sodium;4-(2,4-dinitrophenyl)phenol;hydride?
The InChIKey is ANYDQBDJSNAEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O5.Na.H/c15-10-4-1-8(2-5-10)11-6-3-9(13(16)17)7-12(11)14(18)19;;/h1-7,15H;;/q;+1;-1.
What are the key properties of sodium;4-(2,4-dinitrophenyl)phenol;hydride?
sodium;4-(2,4-dinitrophenyl)phenol;hydride has a molecular weight of 284.20 g/mol, XLogP of -0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(2,4-dinitrophenyl)phenol;hydride is sourced from PubChem (CID 174918783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).