C10H7N3O7 — CID 123875570
3-(2,4-dinitrophenyl)-1-hydroxypyrrole-2,5-diol (PubChem CID 123875570) has the molecular formula C10H7N3O7 and a molecular weight of 281.18 g/mol. Its IUPAC name is 3-(2,4-dinitrophenyl)-1-hydroxypyrrole-2,5-diol.
| Compound Name | 3-(2,4-dinitrophenyl)-1-hydroxypyrrole-2,5-diol |
|---|---|
| PubChem CID | 123875570 |
| Molecular Formula | C10H7N3O7 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 3-(2,4-dinitrophenyl)-1-hydroxypyrrole-2,5-diol |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(O)n(O)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7N3O7/c14-9-4-7(10(15)11(9)16)6-2-1-5(12(17)18)3-8(6)13(19)20/h1-4,14-16H |
| InChIKey | NTJZYCXHWIPWKB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 151.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|