C24H14N4O9 — CID 139793344
1-[2-[2-(2,4-dinitrophenyl)phenoxy]phenyl]-2,4-dinitrobenzene (PubChem CID 139793344) has the molecular formula C24H14N4O9 and a molecular weight of 502.40 g/mol. Its IUPAC name is 1-[2-[2-(2,4-dinitrophenyl)phenoxy]phenyl]-2,4-dinitrobenzene.
| Compound Name | 1-[2-[2-(2,4-dinitrophenyl)phenoxy]phenyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 139793344 |
| Molecular Formula | C24H14N4O9 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 1-[2-[2-(2,4-dinitrophenyl)phenoxy]phenyl]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(-c2ccccc2Oc2ccccc2-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H14N4O9/c29-25(30)15-9-11-17(21(13-15)27(33)34)19-5-1-3-7-23(19)37-24-8-4-2-6-20(24)18-12-10-16(26(31)32)14-22(18)28(35)36/h1-14H |
| InChIKey | LMFOZUXFQSULQH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|