C17H11N7O5 — CID 169398114
2,4-diamino-6-[2-(2,4-dinitrophenoxy)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169398114) has the molecular formula C17H11N7O5 and a molecular weight of 393.32 g/mol. Its IUPAC name is 2,4-diamino-6-[2-(2,4-dinitrophenoxy)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[2-(2,4-dinitrophenoxy)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398114 |
| Molecular Formula | C17H11N7O5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2,4-diamino-6-[2-(2,4-dinitrophenoxy)phenyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11N7O5/c18-8-11-15(21-17(20)22-16(11)19)10-3-1-2-4-13(10)29-14-6-5-9(23(25)26)7-12(14)24(27)28/h1-7H,(H4,19,20,21,22) |
| InChIKey | VWQQCGODZVWGAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|