C12H10N6O3 — CID 169396938
2,4-diamino-6-(2-hydroxy-4-methyl-5-nitrophenyl)pyrimidine-5-carbonitrile (PubChem CID 169396938) has the molecular formula C12H10N6O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2,4-diamino-6-(2-hydroxy-4-methyl-5-nitrophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2-hydroxy-4-methyl-5-nitrophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396938 |
| Molecular Formula | C12H10N6O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2,4-diamino-6-(2-hydroxy-4-methyl-5-nitrophenyl)pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(O)c(-c2nc(N)nc(N)c2C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N6O3/c1-5-2-9(19)6(3-8(5)18(20)21)10-7(4-13)11(14)17-12(15)16-10/h2-3,19H,1H3,(H4,14,15,16,17) |
| InChIKey | VFKRYQJSJJJMLF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 164.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|