C11H10BN5O3 — CID 169398910
[3-(2,6-diamino-5-cyanopyrimidin-4-yl)-4-hydroxyphenyl]boronic acid (PubChem CID 169398910) has the molecular formula C11H10BN5O3 and a molecular weight of 271.05 g/mol. Its IUPAC name is [3-(2,6-diamino-5-cyanopyrimidin-4-yl)-4-hydroxyphenyl]boronic acid.
| Compound Name | [3-(2,6-diamino-5-cyanopyrimidin-4-yl)-4-hydroxyphenyl]boronic acid |
|---|---|
| PubChem CID | 169398910 |
| Molecular Formula | C11H10BN5O3 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [3-(2,6-diamino-5-cyanopyrimidin-4-yl)-4-hydroxyphenyl]boronic acid |
| SMILES | N#Cc1c(N)nc(N)nc1-c1cc(B(O)O)ccc1O |
| InChI | InChI=1S/C11H10BN5O3/c13-4-7-9(16-11(15)17-10(7)14)6-3-5(12(19)20)1-2-8(6)18/h1-3,18-20H,(H4,14,15,16,17) |
| InChIKey | QLBJZAGOTPMLLA-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|