C11H8IN5O — CID 169397267
2,4-diamino-6-(5-hydroxy-2-iodophenyl)pyrimidine-5-carbonitrile (PubChem CID 169397267) has the molecular formula C11H8IN5O and a molecular weight of 353.12 g/mol. Its IUPAC name is 2,4-diamino-6-(5-hydroxy-2-iodophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(5-hydroxy-2-iodophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397267 |
| Molecular Formula | C11H8IN5O |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 2,4-diamino-6-(5-hydroxy-2-iodophenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1cc(O)ccc1I |
| InChI | InChI=1S/C11H8IN5O/c12-8-2-1-5(18)3-6(8)9-7(4-13)10(14)17-11(15)16-9/h1-3,18H,(H4,14,15,16,17) |
| InChIKey | QACAJEQMWZKPGR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|