C11H8ClN5 — CID 169398559
2,4-diamino-6-(2-chlorophenyl)pyrimidine-5-carbonitrile (PubChem CID 169398559) has the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. Its IUPAC name is 2,4-diamino-6-(2-chlorophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2-chlorophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398559 |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,4-diamino-6-(2-chlorophenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C11H8ClN5/c12-8-4-2-1-3-6(8)9-7(5-13)10(14)17-11(15)16-9/h1-4H,(H4,14,15,16,17) |
| InChIKey | NPCAUVQRDVJQJO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |