C16H12N6O — CID 169397318
2,4-diamino-6-(2-pyridin-3-yloxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169397318) has the molecular formula C16H12N6O and a molecular weight of 304.31 g/mol. Its IUPAC name is 2,4-diamino-6-(2-pyridin-3-yloxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2-pyridin-3-yloxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397318 |
| Molecular Formula | C16H12N6O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,4-diamino-6-(2-pyridin-3-yloxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccccc1Oc1cccnc1 |
| InChI | InChI=1S/C16H12N6O/c17-8-12-14(21-16(19)22-15(12)18)11-5-1-2-6-13(11)23-10-4-3-7-20-9-10/h1-7,9H,(H4,18,19,21,22) |
| InChIKey | UCCFTISYKBEVFJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |