C13H9F4N5O — CID 169398772
2,4-diamino-6-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169398772) has the molecular formula C13H9F4N5O and a molecular weight of 327.24 g/mol. Its IUPAC name is 2,4-diamino-6-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398772 |
| Molecular Formula | C13H9F4N5O |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2,4-diamino-6-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C13H9F4N5O/c14-11(15)13(16,17)23-8-4-2-1-3-6(8)9-7(5-18)10(19)22-12(20)21-9/h1-4,11H,(H4,19,20,21,22) |
| InChIKey | MYUFVIPJUPQNBK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|