C11H9N5O3 — CID 169396057
2,4-diamino-6-(2,3,4-trihydroxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169396057) has the molecular formula C11H9N5O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 2,4-diamino-6-(2,3,4-trihydroxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2,3,4-trihydroxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396057 |
| Molecular Formula | C11H9N5O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,4-diamino-6-(2,3,4-trihydroxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C11H9N5O3/c12-3-5-7(15-11(14)16-10(5)13)4-1-2-6(17)9(19)8(4)18/h1-2,17-19H,(H4,13,14,15,16) |
| InChIKey | DDYSNQMTHGLLDV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|