C11H7IN6O2 — CID 169398783
2,4-diamino-6-(4-iodo-3-nitrophenyl)pyrimidine-5-carbonitrile (PubChem CID 169398783) has the molecular formula C11H7IN6O2 and a molecular weight of 382.12 g/mol. Its IUPAC name is 2,4-diamino-6-(4-iodo-3-nitrophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(4-iodo-3-nitrophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398783 |
| Molecular Formula | C11H7IN6O2 |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2,4-diamino-6-(4-iodo-3-nitrophenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc(I)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7IN6O2/c12-7-2-1-5(3-8(7)18(19)20)9-6(4-13)10(14)17-11(15)16-9/h1-3H,(H4,14,15,16,17) |
| InChIKey | QPNPLXUOVYYGLF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|