C13H12N6O4 — CID 169396946
2,4-diamino-6-(2,3-dimethoxy-6-nitrophenyl)pyrimidine-5-carbonitrile (PubChem CID 169396946) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is 2,4-diamino-6-(2,3-dimethoxy-6-nitrophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2,3-dimethoxy-6-nitrophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396946 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2,4-diamino-6-(2,3-dimethoxy-6-nitrophenyl)pyrimidine-5-carbonitrile |
| SMILES | COc1ccc([N+](=O)[O-])c(-c2nc(N)nc(N)c2C#N)c1OC |
| InChI | InChI=1S/C13H12N6O4/c1-22-8-4-3-7(19(20)21)9(11(8)23-2)10-6(5-14)12(15)18-13(16)17-10/h3-4H,1-2H3,(H4,15,16,17,18) |
| InChIKey | WJHVDWOPUXNTHY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|