C12H10N6O4 — CID 169396294
2,4-diamino-6-(2-hydroxy-3-methoxy-5-nitrophenyl)pyrimidine-5-carbonitrile (PubChem CID 169396294) has the molecular formula C12H10N6O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2,4-diamino-6-(2-hydroxy-3-methoxy-5-nitrophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2-hydroxy-3-methoxy-5-nitrophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396294 |
| Molecular Formula | C12H10N6O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,4-diamino-6-(2-hydroxy-3-methoxy-5-nitrophenyl)pyrimidine-5-carbonitrile |
| SMILES | COc1cc([N+](=O)[O-])cc(-c2nc(N)nc(N)c2C#N)c1O |
| InChI | InChI=1S/C12H10N6O4/c1-22-8-3-5(18(20)21)2-6(10(8)19)9-7(4-13)11(14)17-12(15)16-9/h2-3,19H,1H3,(H4,14,15,16,17) |
| InChIKey | ITHYJXOLWCKOGR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 174.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|