C12H8N6O4 — CID 169396969
2-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-nitrobenzoic acid (PubChem CID 169396969) has the molecular formula C12H8N6O4 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-nitrobenzoic acid.
| Compound Name | 2-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 169396969 |
| Molecular Formula | C12H8N6O4 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-nitrobenzoic acid |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C12H8N6O4/c13-4-8-9(16-12(15)17-10(8)14)6-2-1-5(18(21)22)3-7(6)11(19)20/h1-3H,(H,19,20)(H4,14,15,16,17) |
| InChIKey | GZDVGRFDYYJQCM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 182.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|