C12H10N6O4S — CID 169398586
2,4-diamino-6-(4-methylsulfonyl-2-nitrophenyl)pyrimidine-5-carbonitrile (PubChem CID 169398586) has the molecular formula C12H10N6O4S and a molecular weight of 334.32 g/mol. Its IUPAC name is 2,4-diamino-6-(4-methylsulfonyl-2-nitrophenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(4-methylsulfonyl-2-nitrophenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398586 |
| Molecular Formula | C12H10N6O4S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2,4-diamino-6-(4-methylsulfonyl-2-nitrophenyl)pyrimidine-5-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(N)nc(N)c2C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N6O4S/c1-23(21,22)6-2-3-7(9(4-6)18(19)20)10-8(5-13)11(14)17-12(15)16-10/h2-4H,1H3,(H4,14,15,16,17) |
| InChIKey | LVAXZAFPDVCYJB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 178.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|