C19H14N6O5 — CID 169398738
methyl 2-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenoxy]-5-nitrobenzoate (PubChem CID 169398738) has the molecular formula C19H14N6O5 and a molecular weight of 406.36 g/mol. Its IUPAC name is methyl 2-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenoxy]-5-nitrobenzoate.
| Compound Name | methyl 2-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenoxy]-5-nitrobenzoate |
|---|---|
| PubChem CID | 169398738 |
| Molecular Formula | C19H14N6O5 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | methyl 2-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenoxy]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1Oc1cccc(-c2nc(N)nc(N)c2C#N)c1 |
| InChI | InChI=1S/C19H14N6O5/c1-29-18(26)13-8-11(25(27)28)5-6-15(13)30-12-4-2-3-10(7-12)16-14(9-20)17(21)24-19(22)23-16/h2-8H,1H3,(H4,21,22,23,24) |
| InChIKey | IBQFQRFEAJLEMX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|