C14H13N5O3 — CID 169396062
[4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] acetate (PubChem CID 169396062) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 169396062 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(-c2nc(N)nc(N)c2C#N)ccc1OC(C)=O |
| InChI | InChI=1S/C14H13N5O3/c1-7(20)22-10-4-3-8(5-11(10)21-2)12-9(6-15)13(16)19-14(17)18-12/h3-5H,1-2H3,(H4,16,17,18,19) |
| InChIKey | PWBPVSRVWWKBQV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|