C16H17N5O3 — CID 169397574
[5-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate (PubChem CID 169397574) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is [5-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate.
| Compound Name | [5-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 169397574 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [5-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate |
| SMILES | CCOc1ccc(-c2nc(N)nc(N)c2C#N)cc1COC(C)=O |
| InChI | InChI=1S/C16H17N5O3/c1-3-23-13-5-4-10(6-11(13)8-24-9(2)22)14-12(7-17)15(18)21-16(19)20-14/h4-6H,3,8H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | JHLMUMOXGHLKSX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |