C16H19N5O — CID 169396506
2,4-diamino-6-(4-butoxy-3-methylphenyl)pyrimidine-5-carbonitrile (PubChem CID 169396506) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is 2,4-diamino-6-(4-butoxy-3-methylphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(4-butoxy-3-methylphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396506 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2,4-diamino-6-(4-butoxy-3-methylphenyl)pyrimidine-5-carbonitrile |
| SMILES | CCCCOc1ccc(-c2nc(N)nc(N)c2C#N)cc1C |
| InChI | InChI=1S/C16H19N5O/c1-3-4-7-22-13-6-5-11(8-10(13)2)14-12(9-17)15(18)21-16(19)20-14/h5-6,8H,3-4,7H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | AHZOUROKUSKRFX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|